C24H30N2O4 — CID 146120480
(3S,3aS,9bR)-N-(3-methoxyphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide (PubChem CID 146120480) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is (3S,3aS,9bR)-N-(3-methoxyphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,9bR)-N-(3-methoxyphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 146120480 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (3S,3aS,9bR)-N-(3-methoxyphenyl)-3-(2-methylpropoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
| SMILES | COc1cccc(NC(=O)N2C[C@@H](COCC(C)C)[C@@H]3COc4ccccc4[C@@H]32)c1 |
| InChI | InChI=1S/C24H30N2O4/c1-16(2)13-29-14-17-12-26(24(27)25-18-7-6-8-19(11-18)28-3)23-20-9-4-5-10-22(20)30-15-21(17)23/h4-11,16-17,21,23H,12-15H2,1-3H3,(H,25,27)/t17-,21-,23-/m0/s1 |
| InChIKey | ZSAMNNGVZUYPBL-HYVJGQCMSA-N |
| XLogP | 4.58 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |