C23H24F2N2O3 — CID 146120562
(3S,3aS,9bR)-3-(cyclopropylmethoxymethyl)-N-(3,5-difluorophenyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide (PubChem CID 146120562) has the molecular formula C23H24F2N2O3 and a molecular weight of 414.45 g/mol. Its IUPAC name is (3S,3aS,9bR)-3-(cyclopropylmethoxymethyl)-N-(3,5-difluorophenyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide.
| Compound Name | (3S,3aS,9bR)-3-(cyclopropylmethoxymethyl)-N-(3,5-difluorophenyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 146120562 |
| Molecular Formula | C23H24F2N2O3 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (3S,3aS,9bR)-3-(cyclopropylmethoxymethyl)-N-(3,5-difluorophenyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrole-1-carboxamide |
| SMILES | O=C(Nc1cc(F)cc(F)c1)N1C[C@@H](COCC2CC2)[C@@H]2COc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C23H24F2N2O3/c24-16-7-17(25)9-18(8-16)26-23(28)27-10-15(12-29-11-14-5-6-14)20-13-30-21-4-2-1-3-19(21)22(20)27/h1-4,7-9,14-15,20,22H,5-6,10-13H2,(H,26,28)/t15-,20-,22-/m0/s1 |
| InChIKey | WVMCJUPBASQDCA-LVWPNOBMSA-N |
| XLogP | 4.61 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |