C18H23FN2O4 — CID 146120693
[(3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-morpholin-4-ylmethanone (PubChem CID 146120693) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is [(3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 146120693 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | [(3S,3aS,9bR)-8-fluoro-3-(methoxymethyl)-3,3a,4,9b-tetrahydro-2H-chromeno[4,3-b]pyrrol-1-yl]-morpholin-4-ylmethanone |
| SMILES | COC[C@@H]1CN(C(=O)N2CCOCC2)[C@H]2c3cc(F)ccc3OC[C@@H]12 |
| InChI | InChI=1S/C18H23FN2O4/c1-23-10-12-9-21(18(22)20-4-6-24-7-5-20)17-14-8-13(19)2-3-16(14)25-11-15(12)17/h2-3,8,12,15,17H,4-7,9-11H2,1H3/t12-,15-,17-/m0/s1 |
| InChIKey | WZRIWDIYYTXCFM-NUTKFTJISA-N |
| XLogP | 1.91 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |