C9H10FNO2 — CID 117201919
O-[(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methyl]hydroxylamine (PubChem CID 117201919) has the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. Its IUPAC name is O-[(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methyl]hydroxylamine.
| Compound Name | O-[(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117201919 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | O-[(5-fluoro-2,3-dihydro-1-benzofuran-3-yl)methyl]hydroxylamine |
| SMILES | NOCC1COc2ccc(F)cc21 |
| InChI | InChI=1S/C9H10FNO2/c10-7-1-2-9-8(3-7)6(4-12-9)5-13-11/h1-3,6H,4-5,11H2 |
| InChIKey | MHCNNIYXZILOEC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|