C13H15ClN2O4 — CID 78927127
methyl 4-[(2-chlorophenyl)carbamoyl]morpholine-2-carboxylate (PubChem CID 78927127) has the molecular formula C13H15ClN2O4 and a molecular weight of 298.73 g/mol. Its IUPAC name is methyl 4-[(2-chlorophenyl)carbamoyl]morpholine-2-carboxylate.
| Compound Name | methyl 4-[(2-chlorophenyl)carbamoyl]morpholine-2-carboxylate |
|---|---|
| PubChem CID | 78927127 |
| Molecular Formula | C13H15ClN2O4 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | methyl 4-[(2-chlorophenyl)carbamoyl]morpholine-2-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)Nc2ccccc2Cl)CCO1 |
| InChI | InChI=1S/C13H15ClN2O4/c1-19-12(17)11-8-16(6-7-20-11)13(18)15-10-5-3-2-4-9(10)14/h2-5,11H,6-8H2,1H3,(H,15,18) |
| InChIKey | WKQFHHRMZQUYKZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |