C7H3N3O5S — CID 14612052
3,7-dinitro-4-oxidothieno[3,2-b]pyridin-4-ium (PubChem CID 14612052) has the molecular formula C7H3N3O5S and a molecular weight of 241.18 g/mol. Its IUPAC name is 3,7-dinitro-4-oxidothieno[3,2-b]pyridin-4-ium.
| Compound Name | 3,7-dinitro-4-oxidothieno[3,2-b]pyridin-4-ium |
|---|---|
| PubChem CID | 14612052 |
| Molecular Formula | C7H3N3O5S |
| Molecular Weight | 241.18 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 3,7-dinitro-4-oxidothieno[3,2-b]pyridin-4-ium |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c2c([N+](=O)[O-])csc12 |
| InChI | InChI=1S/C7H3N3O5S/c11-8-2-1-4(9(12)13)7-6(8)5(3-16-7)10(14)15/h1-3H |
| InChIKey | RLEWXSKPYFHGOP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|