C10H4F3NO3S — CID 176906453
2,2,2-trifluoro-1-(7-nitro-1-benzothiophen-3-yl)ethanone (PubChem CID 176906453) has the molecular formula C10H4F3NO3S and a molecular weight of 275.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(7-nitro-1-benzothiophen-3-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(7-nitro-1-benzothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 176906453 |
| Molecular Formula | C10H4F3NO3S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | 2,2,2-trifluoro-1-(7-nitro-1-benzothiophen-3-yl)ethanone |
| SMILES | O=C(c1csc2c([N+](=O)[O-])cccc12)C(F)(F)F |
| InChI | InChI=1S/C10H4F3NO3S/c11-10(12,13)9(15)6-4-18-8-5(6)2-1-3-7(8)14(16)17/h1-4H |
| InChIKey | CNQKLUDFPNOHHJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|