C7H5N3O3 — CID 159986800
4-nitro-7-oxido-3H-pyrrolo[2,3-b]pyridin-7-ium (PubChem CID 159986800) has the molecular formula C7H5N3O3 and a molecular weight of 179.14 g/mol. Its IUPAC name is 4-nitro-7-oxido-3H-pyrrolo[2,3-b]pyridin-7-ium.
| Compound Name | 4-nitro-7-oxido-3H-pyrrolo[2,3-b]pyridin-7-ium |
|---|---|
| PubChem CID | 159986800 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-nitro-7-oxido-3H-pyrrolo[2,3-b]pyridin-7-ium |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])c2c1CC=N2 |
| InChI | InChI=1S/C7H5N3O3/c11-9-4-2-6(10(12)13)5-1-3-8-7(5)9/h2-4H,1H2 |
| InChIKey | OGLBNZOWFPZOCF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 82.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|