C12H19N3O3S — CID 146125787
5-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-3-methyl-1,2-thiazole-4-carbonitrile (PubChem CID 146125787) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 5-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-3-methyl-1,2-thiazole-4-carbonitrile.
| Compound Name | 5-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-3-methyl-1,2-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 146125787 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 5-[[3-(2-ethoxyethoxy)-2-hydroxypropyl]amino]-3-methyl-1,2-thiazole-4-carbonitrile |
| SMILES | CCOCCOCC(O)CNc1snc(C)c1C#N |
| InChI | InChI=1S/C12H19N3O3S/c1-3-17-4-5-18-8-10(16)7-14-12-11(6-13)9(2)15-19-12/h10,14,16H,3-5,7-8H2,1-2H3 |
| InChIKey | LEWHTRIFPCWLHD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|