C16H12N2O — CID 14612598
13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one (PubChem CID 14612598) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one.
| Compound Name | 13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
|---|---|
| PubChem CID | 14612598 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
| SMILES | Cc1c[nH]c(=O)c2c1[nH]c1ccc3ccccc3c12 |
| InChI | InChI=1S/C16H12N2O/c1-9-8-17-16(19)14-13-11-5-3-2-4-10(11)6-7-12(13)18-15(9)14/h2-8,18H,1H3,(H,17,19) |
| InChIKey | RNGPSODUEBWZRO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |