C14H9N3O — CID 136740086
11,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one (PubChem CID 136740086) has the molecular formula C14H9N3O and a molecular weight of 235.25 g/mol. Its IUPAC name is 11,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one.
| Compound Name | 11,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
|---|---|
| PubChem CID | 136740086 |
| Molecular Formula | C14H9N3O |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 11,13,15-triazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2,4,6,8,12(17),13-heptaen-16-one |
| SMILES | O=c1[nH]cnc2[nH]c3ccc4ccccc4c3c12 |
| InChI | InChI=1S/C14H9N3O/c18-14-12-11-9-4-2-1-3-8(9)5-6-10(11)17-13(12)15-7-16-14/h1-7H,(H2,15,16,17,18) |
| InChIKey | ONZHMZCGGDDBIC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |