C14H9N3O2 — CID 136911032
5-(1-benzofuran-2-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 136911032) has the molecular formula C14H9N3O2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 5-(1-benzofuran-2-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(1-benzofuran-2-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 136911032 |
| Molecular Formula | C14H9N3O2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 5-(1-benzofuran-2-yl)-3,7-dihydropyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2[nH]cc(-c3cc4ccccc4o3)c12 |
| InChI | InChI=1S/C14H9N3O2/c18-14-12-9(6-15-13(12)16-7-17-14)11-5-8-3-1-2-4-10(8)19-11/h1-7H,(H2,15,16,17,18) |
| InChIKey | KNWNKYRODZZMCT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |