C12H7BrN2O2 — CID 66316989
2-(1-benzofuran-2-yl)-5-bromo-1H-pyrimidin-6-one (PubChem CID 66316989) has the molecular formula C12H7BrN2O2 and a molecular weight of 291.10 g/mol. Its IUPAC name is 2-(1-benzofuran-2-yl)-5-bromo-1H-pyrimidin-6-one.
| Compound Name | 2-(1-benzofuran-2-yl)-5-bromo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 66316989 |
| Molecular Formula | C12H7BrN2O2 |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.97 |
| IUPAC Name | 2-(1-benzofuran-2-yl)-5-bromo-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2cc3ccccc3o2)ncc1Br |
| InChI | InChI=1S/C12H7BrN2O2/c13-8-6-14-11(15-12(8)16)10-5-7-3-1-2-4-9(7)17-10/h1-6H,(H,14,15,16) |
| InChIKey | RCVGWMHYUXRJIP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |