C13H9N3O3 — CID 135958416
2-amino-4-(1-benzofuran-2-yl)-1H-1,3-diazepine-6,7-dione (PubChem CID 135958416) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-amino-4-(1-benzofuran-2-yl)-1H-1,3-diazepine-6,7-dione.
| Compound Name | 2-amino-4-(1-benzofuran-2-yl)-1H-1,3-diazepine-6,7-dione |
|---|---|
| PubChem CID | 135958416 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-amino-4-(1-benzofuran-2-yl)-1H-1,3-diazepine-6,7-dione |
| SMILES | Nc1nc(-c2cc3ccccc3o2)cc(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H9N3O3/c14-13-15-8(6-9(17)12(18)16-13)11-5-7-3-1-2-4-10(7)19-11/h1-6H,(H3,14,15,16,17,18) |
| InChIKey | AXAHIUPVLSRKGT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|