C13H11F3N2O2S — CID 146127486
2-methyl-N-pyridin-3-yl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 146127486) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 2-methyl-N-pyridin-3-yl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-methyl-N-pyridin-3-yl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 146127486 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 2-methyl-N-pyridin-3-yl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1S(=O)(=O)Nc1cccnc1 |
| InChI | InChI=1S/C13H11F3N2O2S/c1-9-4-5-10(13(14,15)16)7-12(9)21(19,20)18-11-3-2-6-17-8-11/h2-8,18H,1H3 |
| InChIKey | OZCQPTYBJGVQJV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |