C24H26N4O4S — CID 37119295
5-tert-butyl-2-methyl-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]benzenesulfonamide (PubChem CID 37119295) has the molecular formula C24H26N4O4S and a molecular weight of 466.56 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | 5-tert-butyl-2-methyl-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 37119295 |
| Molecular Formula | C24H26N4O4S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | 5-tert-butyl-2-methyl-N-[3-[(pyridine-3-carbonylamino)carbamoyl]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(C)(C)C)cc1S(=O)(=O)Nc1cccc(C(=O)NNC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H26N4O4S/c1-16-10-11-19(24(2,3)4)14-21(16)33(31,32)28-20-9-5-7-17(13-20)22(29)26-27-23(30)18-8-6-12-25-15-18/h5-15,28H,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | JPCYIEZMZCHDAD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|