C22H26FN3O4S — CID 146127558
3-(dimethylsulfamoyl)-N-[2-[[3-(3-fluorophenyl)cyclopentyl]amino]-2-oxoethyl]benzamide (PubChem CID 146127558) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[2-[[3-(3-fluorophenyl)cyclopentyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[2-[[3-(3-fluorophenyl)cyclopentyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 146127558 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[2-[[3-(3-fluorophenyl)cyclopentyl]amino]-2-oxoethyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NCC(=O)NC2CCC(c3cccc(F)c3)C2)c1 |
| InChI | InChI=1S/C22H26FN3O4S/c1-26(2)31(29,30)20-8-4-6-17(13-20)22(28)24-14-21(27)25-19-10-9-16(12-19)15-5-3-7-18(23)11-15/h3-8,11,13,16,19H,9-10,12,14H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | BICFMGXIUFGDFK-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |