C19H31N4O4S+ — CID 9293099
3-(dimethylsulfamoyl)-N-[2-oxo-2-[(1-propylpiperidin-1-ium-4-yl)amino]ethyl]benzamide (PubChem CID 9293099) has the molecular formula C19H31N4O4S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[2-oxo-2-[(1-propylpiperidin-1-ium-4-yl)amino]ethyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[2-oxo-2-[(1-propylpiperidin-1-ium-4-yl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 9293099 |
| Molecular Formula | C19H31N4O4S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[2-oxo-2-[(1-propylpiperidin-1-ium-4-yl)amino]ethyl]benzamide |
| SMILES | CCC[NH+]1CCC(NC(=O)CNC(=O)c2cccc(S(=O)(=O)N(C)C)c2)CC1 |
| InChI | InChI=1S/C19H30N4O4S/c1-4-10-23-11-8-16(9-12-23)21-18(24)14-20-19(25)15-6-5-7-17(13-15)28(26,27)22(2)3/h5-7,13,16H,4,8-12,14H2,1-3H3,(H,20,25)(H,21,24)/p+1 |
| InChIKey | SNRABSZPQRTDPV-UHFFFAOYSA-O |
| XLogP | -0.76 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |