C19H26N4O2 — CID 146128739
3-ethyl-3-(hydroxymethyl)-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1-carboxamide (PubChem CID 146128739) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-ethyl-3-(hydroxymethyl)-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1-carboxamide.
| Compound Name | 3-ethyl-3-(hydroxymethyl)-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 146128739 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-ethyl-3-(hydroxymethyl)-N-[2-(2-methylphenyl)pyrazol-3-yl]piperidine-1-carboxamide |
| SMILES | CCC1(CO)CCCN(C(=O)Nc2ccnn2-c2ccccc2C)C1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-19(14-24)10-6-12-22(13-19)18(25)21-17-9-11-20-23(17)16-8-5-4-7-15(16)2/h4-5,7-9,11,24H,3,6,10,12-14H2,1-2H3,(H,21,25) |
| InChIKey | XPOCJHAOROZVBD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |