C17H21N5O2 — CID 84598089
N-[2-[[2-(2-methylphenyl)pyrazol-3-yl]carbamoylamino]ethyl]cyclopropanecarboxamide (PubChem CID 84598089) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[2-[[2-(2-methylphenyl)pyrazol-3-yl]carbamoylamino]ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[2-(2-methylphenyl)pyrazol-3-yl]carbamoylamino]ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 84598089 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[2-[[2-(2-methylphenyl)pyrazol-3-yl]carbamoylamino]ethyl]cyclopropanecarboxamide |
| SMILES | Cc1ccccc1-n1nccc1NC(=O)NCCNC(=O)C1CC1 |
| InChI | InChI=1S/C17H21N5O2/c1-12-4-2-3-5-14(12)22-15(8-9-20-22)21-17(24)19-11-10-18-16(23)13-6-7-13/h2-5,8-9,13H,6-7,10-11H2,1H3,(H,18,23)(H2,19,21,24) |
| InChIKey | OMLBLXAVBRLZDB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|