C20H21N3O4 — CID 75467532
2,4,5-trimethoxy-N-[2-(2-methylphenyl)pyrazol-3-yl]benzamide (PubChem CID 75467532) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[2-(2-methylphenyl)pyrazol-3-yl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[2-(2-methylphenyl)pyrazol-3-yl]benzamide |
|---|---|
| PubChem CID | 75467532 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2,4,5-trimethoxy-N-[2-(2-methylphenyl)pyrazol-3-yl]benzamide |
| SMILES | COc1cc(OC)c(C(=O)Nc2ccnn2-c2ccccc2C)cc1OC |
| InChI | InChI=1S/C20H21N3O4/c1-13-7-5-6-8-15(13)23-19(9-10-21-23)22-20(24)14-11-17(26-3)18(27-4)12-16(14)25-2/h5-12H,1-4H3,(H,22,24) |
| InChIKey | DTQCJJTZXSMXTA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |