C12H13F2NO6S — CID 146129203
2-[4-[3-(difluoromethoxy)azetidin-1-yl]sulfonylphenoxy]acetic acid (PubChem CID 146129203) has the molecular formula C12H13F2NO6S and a molecular weight of 337.30 g/mol. Its IUPAC name is 2-[4-[3-(difluoromethoxy)azetidin-1-yl]sulfonylphenoxy]acetic acid.
| Compound Name | 2-[4-[3-(difluoromethoxy)azetidin-1-yl]sulfonylphenoxy]acetic acid |
|---|---|
| PubChem CID | 146129203 |
| Molecular Formula | C12H13F2NO6S |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 2-[4-[3-(difluoromethoxy)azetidin-1-yl]sulfonylphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)N2CC(OC(F)F)C2)cc1 |
| InChI | InChI=1S/C12H13F2NO6S/c13-12(14)21-9-5-15(6-9)22(18,19)10-3-1-8(2-4-10)20-7-11(16)17/h1-4,9,12H,5-7H2,(H,16,17) |
| InChIKey | INLTYIRACUANJQ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |