C15H16F2N2O3S — CID 146130162
5-cyclohexyl-3-[(3,4-difluorophenyl)sulfonylmethyl]-1,2,4-oxadiazole (PubChem CID 146130162) has the molecular formula C15H16F2N2O3S and a molecular weight of 342.37 g/mol. Its IUPAC name is 5-cyclohexyl-3-[(3,4-difluorophenyl)sulfonylmethyl]-1,2,4-oxadiazole.
| Compound Name | 5-cyclohexyl-3-[(3,4-difluorophenyl)sulfonylmethyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 146130162 |
| Molecular Formula | C15H16F2N2O3S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 5-cyclohexyl-3-[(3,4-difluorophenyl)sulfonylmethyl]-1,2,4-oxadiazole |
| SMILES | O=S(=O)(Cc1noc(C2CCCCC2)n1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H16F2N2O3S/c16-12-7-6-11(8-13(12)17)23(20,21)9-14-18-15(22-19-14)10-4-2-1-3-5-10/h6-8,10H,1-5,9H2 |
| InChIKey | GZSQDPTUUCXDGO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |