C14H13Cl2N5O2 — CID 146130559
4-[3-(2,6-dichlorophenyl)triazole-4-carbonyl]-6-methylpiperazin-2-one (PubChem CID 146130559) has the molecular formula C14H13Cl2N5O2 and a molecular weight of 354.20 g/mol. Its IUPAC name is 4-[3-(2,6-dichlorophenyl)triazole-4-carbonyl]-6-methylpiperazin-2-one.
| Compound Name | 4-[3-(2,6-dichlorophenyl)triazole-4-carbonyl]-6-methylpiperazin-2-one |
|---|---|
| PubChem CID | 146130559 |
| Molecular Formula | C14H13Cl2N5O2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | 4-[3-(2,6-dichlorophenyl)triazole-4-carbonyl]-6-methylpiperazin-2-one |
| SMILES | CC1CN(C(=O)c2cnnn2-c2c(Cl)cccc2Cl)CC(=O)N1 |
| InChI | InChI=1S/C14H13Cl2N5O2/c1-8-6-20(7-12(22)18-8)14(23)11-5-17-19-21(11)13-9(15)3-2-4-10(13)16/h2-5,8H,6-7H2,1H3,(H,18,22) |
| InChIKey | DKRNSRLKOLRFIJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |