C18H20N2O5 — CID 146135997
1-[[1-(2-methoxyacetyl)-2,3-dihydroindol-4-yl]carbamoyl]cyclopent-3-ene-1-carboxylic acid (PubChem CID 146135997) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 1-[[1-(2-methoxyacetyl)-2,3-dihydroindol-4-yl]carbamoyl]cyclopent-3-ene-1-carboxylic acid.
| Compound Name | 1-[[1-(2-methoxyacetyl)-2,3-dihydroindol-4-yl]carbamoyl]cyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 146135997 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 1-[[1-(2-methoxyacetyl)-2,3-dihydroindol-4-yl]carbamoyl]cyclopent-3-ene-1-carboxylic acid |
| SMILES | COCC(=O)N1CCc2c(NC(=O)C3(C(=O)O)CC=CC3)cccc21 |
| InChI | InChI=1S/C18H20N2O5/c1-25-11-15(21)20-10-7-12-13(5-4-6-14(12)20)19-16(22)18(17(23)24)8-2-3-9-18/h2-6H,7-11H2,1H3,(H,19,22)(H,23,24) |
| InChIKey | QUNBJKSFYSTGGT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|