C16H16F3N3OS — CID 146140370
7-[[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]methylamino]-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 146140370) has the molecular formula C16H16F3N3OS and a molecular weight of 355.39 g/mol. Its IUPAC name is 7-[[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]methylamino]-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | 7-[[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]methylamino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 146140370 |
| Molecular Formula | C16H16F3N3OS |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 7-[[2-(2,2,2-trifluoroethyl)-1,3-thiazol-5-yl]methylamino]-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1CCCc2cc(NCc3cnc(CC(F)(F)F)s3)ccc2N1 |
| InChI | InChI=1S/C16H16F3N3OS/c17-16(18,19)7-15-21-9-12(24-15)8-20-11-4-5-13-10(6-11)2-1-3-14(23)22-13/h4-6,9,20H,1-3,7-8H2,(H,22,23) |
| InChIKey | STERYBGNZAWWDR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |