C19H19F3N4O2 — CID 75472749
N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide (PubChem CID 75472749) has the molecular formula C19H19F3N4O2 and a molecular weight of 392.38 g/mol. Its IUPAC name is N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide.
| Compound Name | N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 75472749 |
| Molecular Formula | C19H19F3N4O2 |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | N-(2-oxo-1,3,4,5-tetrahydro-1-benzazepin-7-yl)-3-(trifluoromethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-7-carboxamide |
| SMILES | O=C1CCCc2cc(NC(=O)C3CCn4c(cnc4C(F)(F)F)C3)ccc2N1 |
| InChI | InChI=1S/C19H19F3N4O2/c20-19(21,22)18-23-10-14-9-12(6-7-26(14)18)17(28)24-13-4-5-15-11(8-13)2-1-3-16(27)25-15/h4-5,8,10,12H,1-3,6-7,9H2,(H,24,28)(H,25,27) |
| InChIKey | FLURYTJPJCBUOA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |