C14H15N5O4 — CID 146141561
2-(3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-N-(2-nitrophenyl)acetamide (PubChem CID 146141561) has the molecular formula C14H15N5O4 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2-(3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-(3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 146141561 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-(3-amino-6,7-dihydro-4H-[1,2]oxazolo[4,3-c]pyridin-5-yl)-N-(2-nitrophenyl)acetamide |
| SMILES | Nc1onc2c1CN(CC(=O)Nc1ccccc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C14H15N5O4/c15-14-9-7-18(6-5-10(9)17-23-14)8-13(20)16-11-3-1-2-4-12(11)19(21)22/h1-4H,5-8,15H2,(H,16,20) |
| InChIKey | AAVWQXKVUHGSKA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|