C15H19NO4S — CID 146141879
methyl (E)-4-[2-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)propanoylamino]but-2-enoate (PubChem CID 146141879) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl (E)-4-[2-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)propanoylamino]but-2-enoate.
| Compound Name | methyl (E)-4-[2-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)propanoylamino]but-2-enoate |
|---|---|
| PubChem CID | 146141879 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl (E)-4-[2-(6,7-dihydro-4H-thieno[3,2-c]pyran-4-yl)propanoylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/CNC(=O)C(C)C1OCCc2sccc21 |
| InChI | InChI=1S/C15H19NO4S/c1-10(15(18)16-7-3-4-13(17)19-2)14-11-6-9-21-12(11)5-8-20-14/h3-4,6,9-10,14H,5,7-8H2,1-2H3,(H,16,18)/b4-3+ |
| InChIKey | ARVKFDBKOBBOHU-ONEGZZNKSA-N |
| XLogP | 1.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|