C13H13ClFNO4 — CID 146142387
1-[(5-chloro-2-fluorobenzoyl)amino]-3-methoxycyclobutane-1-carboxylic acid (PubChem CID 146142387) has the molecular formula C13H13ClFNO4 and a molecular weight of 301.70 g/mol. Its IUPAC name is 1-[(5-chloro-2-fluorobenzoyl)amino]-3-methoxycyclobutane-1-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-fluorobenzoyl)amino]-3-methoxycyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 146142387 |
| Molecular Formula | C13H13ClFNO4 |
| Molecular Weight | 301.70 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-[(5-chloro-2-fluorobenzoyl)amino]-3-methoxycyclobutane-1-carboxylic acid |
| SMILES | COC1CC(NC(=O)c2cc(Cl)ccc2F)(C(=O)O)C1 |
| InChI | InChI=1S/C13H13ClFNO4/c1-20-8-5-13(6-8,12(18)19)16-11(17)9-4-7(14)2-3-10(9)15/h2-4,8H,5-6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | IGLZHDYKRRQOIA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.70 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |