C13H18N4O2 — CID 146143412
3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 146143412) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 146143412 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-[(1-cyclopentylpyrazol-3-yl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCNC(=O)N1Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H18N4O2/c18-12-5-7-14-13(19)16(12)9-10-6-8-17(15-10)11-3-1-2-4-11/h6,8,11H,1-5,7,9H2,(H,14,19) |
| InChIKey | SZLGTLDGGSYOJB-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |