C15H19F2NO3 — CID 146145494
5-[2-(2,6-difluorophenyl)propanoyl-methylamino]pentanoic acid (PubChem CID 146145494) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is 5-[2-(2,6-difluorophenyl)propanoyl-methylamino]pentanoic acid.
| Compound Name | 5-[2-(2,6-difluorophenyl)propanoyl-methylamino]pentanoic acid |
|---|---|
| PubChem CID | 146145494 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-[2-(2,6-difluorophenyl)propanoyl-methylamino]pentanoic acid |
| SMILES | CC(C(=O)N(C)CCCCC(=O)O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H19F2NO3/c1-10(14-11(16)6-5-7-12(14)17)15(21)18(2)9-4-3-8-13(19)20/h5-7,10H,3-4,8-9H2,1-2H3,(H,19,20) |
| InChIKey | ONFNMIFPJFFVFF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|