C14H13N5O2S — CID 146146572
[5-(2H-tetrazol-5-yl)furan-3-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone (PubChem CID 146146572) has the molecular formula C14H13N5O2S and a molecular weight of 315.36 g/mol. Its IUPAC name is [5-(2H-tetrazol-5-yl)furan-3-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | [5-(2H-tetrazol-5-yl)furan-3-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 146146572 |
| Molecular Formula | C14H13N5O2S |
| Molecular Weight | 315.36 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | [5-(2H-tetrazol-5-yl)furan-3-yl]-(2-thiophen-2-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1coc(-c2nn[nH]n2)c1)N1CCCC1c1cccs1 |
| InChI | InChI=1S/C14H13N5O2S/c20-14(9-7-11(21-8-9)13-15-17-18-16-13)19-5-1-3-10(19)12-4-2-6-22-12/h2,4,6-8,10H,1,3,5H2,(H,15,16,17,18) |
| InChIKey | SHFGMMQTNXUKFO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |