C17H13FN2O3S — CID 146148643
1,3,4-thiadiazol-2-ylmethyl 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 146148643) has the molecular formula C17H13FN2O3S and a molecular weight of 344.37 g/mol. Its IUPAC name is 1,3,4-thiadiazol-2-ylmethyl 2-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | 1,3,4-thiadiazol-2-ylmethyl 2-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 146148643 |
| Molecular Formula | C17H13FN2O3S |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 1,3,4-thiadiazol-2-ylmethyl 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | O=C(OCc1nncs1)c1ccccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C17H13FN2O3S/c18-13-7-5-12(6-8-13)9-22-15-4-2-1-3-14(15)17(21)23-10-16-20-19-11-24-16/h1-8,11H,9-10H2 |
| InChIKey | ZOZDOBCIYLFFMU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |