C22H20FNO4S — CID 7439920
[2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 2-[(4-fluorophenyl)methoxy]benzoate (PubChem CID 7439920) has the molecular formula C22H20FNO4S and a molecular weight of 413.47 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 2-[(4-fluorophenyl)methoxy]benzoate.
| Compound Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
|---|---|
| PubChem CID | 7439920 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-thiophen-2-ylethyl]amino]ethyl] 2-[(4-fluorophenyl)methoxy]benzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccccc1OCc1ccc(F)cc1)c1cccs1 |
| InChI | InChI=1S/C22H20FNO4S/c1-15(20-7-4-12-29-20)24-21(25)14-28-22(26)18-5-2-3-6-19(18)27-13-16-8-10-17(23)11-9-16/h2-12,15H,13-14H2,1H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | RRPWKHMXVQHFOC-HNNXBMFYSA-N |
| XLogP | 4.50 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |