C13H16ClN5O2S — CID 146149585
N-[(4-chlorophenyl)-cyclobutylmethyl]-2-methyltetrazole-5-sulfonamide (PubChem CID 146149585) has the molecular formula C13H16ClN5O2S and a molecular weight of 341.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-cyclobutylmethyl]-2-methyltetrazole-5-sulfonamide.
| Compound Name | N-[(4-chlorophenyl)-cyclobutylmethyl]-2-methyltetrazole-5-sulfonamide |
|---|---|
| PubChem CID | 146149585 |
| Molecular Formula | C13H16ClN5O2S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | N-[(4-chlorophenyl)-cyclobutylmethyl]-2-methyltetrazole-5-sulfonamide |
| SMILES | Cn1nnc(S(=O)(=O)NC(c2ccc(Cl)cc2)C2CCC2)n1 |
| InChI | InChI=1S/C13H16ClN5O2S/c1-19-16-13(15-18-19)22(20,21)17-12(9-3-2-4-9)10-5-7-11(14)8-6-10/h5-9,12,17H,2-4H2,1H3 |
| InChIKey | BBATULKGJRSQCW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |