C17H15N5O2 — CID 146153674
3-(furan-3-yl)-N-[(1-methylindazol-4-yl)methyl]-1H-pyrazole-5-carboxamide (PubChem CID 146153674) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 3-(furan-3-yl)-N-[(1-methylindazol-4-yl)methyl]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(furan-3-yl)-N-[(1-methylindazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 146153674 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-(furan-3-yl)-N-[(1-methylindazol-4-yl)methyl]-1H-pyrazole-5-carboxamide |
| SMILES | Cn1ncc2c(CNC(=O)c3cc(-c4ccoc4)n[nH]3)cccc21 |
| InChI | InChI=1S/C17H15N5O2/c1-22-16-4-2-3-11(13(16)9-19-22)8-18-17(23)15-7-14(20-21-15)12-5-6-24-10-12/h2-7,9-10H,8H2,1H3,(H,18,23)(H,20,21) |
| InChIKey | RLFVAXCYQCYDGK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |