C31H43NO9 — CID 146159372
[(1S,5R,8R,13S)-5,7,8-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate (PubChem CID 146159372) has the molecular formula C31H43NO9 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(1S,5R,8R,13S)-5,7,8-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate.
| Compound Name | [(1S,5R,8R,13S)-5,7,8-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
|---|---|
| PubChem CID | 146159372 |
| Molecular Formula | C31H43NO9 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.29 |
| IUPAC Name | [(1S,5R,8R,13S)-5,7,8-trihydroxy-6,16,18-trimethoxy-13-(methoxymethyl)-11-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] benzoate |
| SMILES | COC[C@@]12CCC(OC)[C@@]34C5C[C@]6(O)C(OC)C(O)[C@@](O)(C5C6OC(=O)c5ccccc5)C(C(OC)C13)C4N(C)C2 |
| InChI | InChI=1S/C31H43NO9/c1-32-14-28(15-37-2)12-11-18(38-3)30-17-13-29(35)25(41-27(34)16-9-7-6-8-10-16)19(17)31(36,24(33)26(29)40-5)20(23(30)32)21(39-4)22(28)30/h6-10,17-26,33,35-36H,11-15H2,1-5H3/t17?,18?,19?,20?,21?,22?,23?,24?,25?,26?,28-,29+,30-,31+/m0/s1 |
| InChIKey | MDFCJNFOINXVSU-YMEFYHIPSA-N |
| XLogP | 0.72 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |