C9H10N4O — CID 146160690
11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one (PubChem CID 146160690) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is 11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one.
| Compound Name | 11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
|---|---|
| PubChem CID | 146160690 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 11-methyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-trien-2-one |
| SMILES | Cc1cc2nc3c(c(=O)n2[nH]1)CNC3 |
| InChI | InChI=1S/C9H10N4O/c1-5-2-8-11-7-4-10-3-6(7)9(14)13(8)12-5/h2,10,12H,3-4H2,1H3 |
| InChIKey | ZAWHIYUDGHJMQM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |