C15H15ClN4O — CID 155823406
5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one;hydrochloride (PubChem CID 155823406) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is 5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one;hydrochloride.
| Compound Name | 5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one;hydrochloride |
|---|---|
| PubChem CID | 155823406 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one;hydrochloride |
| SMILES | Cl.O=c1c2c(nc3cc(-c4ccccc4)[nH]n13)CNCC2 |
| InChI | InChI=1S/C15H14N4O.ClH/c20-15-11-6-7-16-9-13(11)17-14-8-12(18-19(14)15)10-4-2-1-3-5-10;/h1-5,8,16,18H,6-7,9H2;1H |
| InChIKey | XMUKBUPGIOJSHP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |