C20H14N4O2 — CID 14867542
5,11-diphenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 14867542) has the molecular formula C20H14N4O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 5,11-diphenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 5,11-diphenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 14867542 |
| Molecular Formula | C20H14N4O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5,11-diphenyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | O=C1c2nc3cc(-c4ccccc4)[nH]n3c(=O)c2CN1c1ccccc1 |
| InChI | InChI=1S/C20H14N4O2/c25-19-15-12-23(14-9-5-2-6-10-14)20(26)18(15)21-17-11-16(22-24(17)19)13-7-3-1-4-8-13/h1-11,22H,12H2 |
| InChIKey | OZRIASIEVQGGCW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |