C17H19N5O3S — CID 53183897
N,N-dimethyl-8-oxo-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-sulfonamide (PubChem CID 53183897) has the molecular formula C17H19N5O3S and a molecular weight of 373.44 g/mol. Its IUPAC name is N,N-dimethyl-8-oxo-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-sulfonamide.
| Compound Name | N,N-dimethyl-8-oxo-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-sulfonamide |
|---|---|
| PubChem CID | 53183897 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N,N-dimethyl-8-oxo-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-12-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCc2c(nc3cc(-c4ccccc4)[nH]n3c2=O)C1 |
| InChI | InChI=1S/C17H19N5O3S/c1-20(2)26(24,25)21-9-8-13-15(11-21)18-16-10-14(19-22(16)17(13)23)12-6-4-3-5-7-12/h3-7,10,19H,8-9,11H2,1-2H3 |
| InChIKey | RSROCDLLHZJLDU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |