C24H20N6O2 — CID 53183865
12-(1-methylindazole-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183865) has the molecular formula C24H20N6O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is 12-(1-methylindazole-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(1-methylindazole-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183865 |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 12-(1-methylindazole-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | Cn1nc(C(=O)N2CCc3c(nc4cc(-c5ccccc5)[nH]n4c3=O)C2)c2ccccc21 |
| InChI | InChI=1S/C24H20N6O2/c1-28-20-10-6-5-9-17(20)22(27-28)24(32)29-12-11-16-19(14-29)25-21-13-18(26-30(21)23(16)31)15-7-3-2-4-8-15/h2-10,13,26H,11-12,14H2,1H3 |
| InChIKey | SXLKDJGJUURBCR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |