C23H21N5O4 — CID 53183858
12-(2,6-dimethoxypyridine-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53183858) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 12-(2,6-dimethoxypyridine-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 12-(2,6-dimethoxypyridine-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53183858 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 12-(2,6-dimethoxypyridine-3-carbonyl)-5-phenyl-2,6,7,12-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | COc1ccc(C(=O)N2CCc3c(nc4cc(-c5ccccc5)[nH]n4c3=O)C2)c(OC)n1 |
| InChI | InChI=1S/C23H21N5O4/c1-31-20-9-8-16(21(25-20)32-2)22(29)27-11-10-15-18(13-27)24-19-12-17(26-28(19)23(15)30)14-6-4-3-5-7-14/h3-9,12,26H,10-11,13H2,1-2H3 |
| InChIKey | MPBAKUBEUSKZRO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |