C21H24N4O3 — CID 53184136
11-(2,2-dimethylpropanoyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 53184136) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 11-(2,2-dimethylpropanoyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-(2,2-dimethylpropanoyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 53184136 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 11-(2,2-dimethylpropanoyl)-5-(4-methoxyphenyl)-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | COc1ccc(-c2cc3nc4c(c(=O)n3[nH]2)CN(C(=O)C(C)(C)C)CC4)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-21(2,3)20(27)24-10-9-16-15(12-24)19(26)25-18(22-16)11-17(23-25)13-5-7-14(28-4)8-6-13/h5-8,11,23H,9-10,12H2,1-4H3 |
| InChIKey | HFYBVFOTHKLIJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |