C22H23N7O5S — CID 87052614
N-[2-[5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl]-2-oxoethyl]-N-methyl-1H-imidazole-5-sulfonamide (PubChem CID 87052614) has the molecular formula C22H23N7O5S and a molecular weight of 497.54 g/mol. Its IUPAC name is N-[2-[5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl]-2-oxoethyl]-N-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-[5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl]-2-oxoethyl]-N-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 87052614 |
| Molecular Formula | C22H23N7O5S |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | N-[2-[5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl]-2-oxoethyl]-N-methyl-1H-imidazole-5-sulfonamide |
| SMILES | COc1ccc(-c2cc3nc4c(c(=O)n3[nH]2)CN(C(=O)CN(C)S(=O)(=O)c2cnc[nH]2)CC4)cc1 |
| InChI | InChI=1S/C22H23N7O5S/c1-27(35(32,33)20-10-23-13-24-20)12-21(30)28-8-7-17-16(11-28)22(31)29-19(25-17)9-18(26-29)14-3-5-15(34-2)6-4-14/h3-6,9-10,13,26H,7-8,11-12H2,1-2H3,(H,23,24) |
| InChIKey | VCXQKQFHQDTBFL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 145.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |