C25H25N5O3 — CID 53184141
N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide (PubChem CID 53184141) has the molecular formula C25H25N5O3 and a molecular weight of 443.51 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
|---|---|
| PubChem CID | 53184141 |
| Molecular Formula | C25H25N5O3 |
| Molecular Weight | 443.51 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | N-(2,4-dimethylphenyl)-5-(4-methoxyphenyl)-8-oxo-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-triene-11-carboxamide |
| SMILES | COc1ccc(-c2cc3nc4c(c(=O)n3[nH]2)CN(C(=O)Nc2ccc(C)cc2C)CC4)cc1 |
| InChI | InChI=1S/C25H25N5O3/c1-15-4-9-20(16(2)12-15)27-25(32)29-11-10-21-19(14-29)24(31)30-23(26-21)13-22(28-30)17-5-7-18(33-3)8-6-17/h4-9,12-13,28H,10-11,14H2,1-3H3,(H,27,32) |
| InChIKey | OGZUWANPOFOLOU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |