C26H39NO4Si — CID 146161737
(4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyloct-7-enoyl]-1,3-oxazolidin-2-one (PubChem CID 146161737) has the molecular formula C26H39NO4Si and a molecular weight of 457.69 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyloct-7-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyloct-7-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146161737 |
| Molecular Formula | C26H39NO4Si |
| Molecular Weight | 457.69 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyloct-7-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C26H39NO4Si/c1-8-10-12-17-23(31-32(6,7)26(3,4)5)22(9-2)24(28)27-21(19-30-25(27)29)18-20-15-13-11-14-16-20/h8-9,11,13-16,21-23H,1-2,10,12,17-19H2,3-7H3/t21-,22-,23+/m0/s1 |
| InChIKey | JGKLQZVOGQUTAB-RJGXRXQPSA-N |
| XLogP | 6.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.69 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|