C15H16O4 — CID 146162008
4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol (PubChem CID 146162008) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol.
| Compound Name | 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 146162008 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol |
| SMILES | COc1c(C)cc(O)c(-c2ccc(O)cc2O)c1C |
| InChI | InChI=1S/C15H16O4/c1-8-6-13(18)14(9(2)15(8)19-3)11-5-4-10(16)7-12(11)17/h4-7,16-18H,1-3H3 |
| InChIKey | VYJJICISZSBXDD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |