About 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol
4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol (PubChem CID 146162008) has the molecular formula C15H16O4
and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol |
| PubChem CID | 146162008 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol |
| SMILES | COc1c(C)cc(O)c(-c2ccc(O)cc2O)c1C |
| InChI | InChI=1S/C15H16O4/c1-8-6-13(18)14(9(2)15(8)19-3)11-5-4-10(16)7-12(11)17/h4-7,16-18H,1-3H3 |
| InChIKey | VYJJICISZSBXDD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol?
The IUPAC name of 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol (CID 146162008) is 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol.
What is the SMILES notation for 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol?
The canonical SMILES for 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol is COc1c(C)cc(O)c(-c2ccc(O)cc2O)c1C.
What is the InChIKey of 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol?
The InChIKey is VYJJICISZSBXDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c1-8-6-13(18)14(9(2)15(8)19-3)11-5-4-10(16)7-12(11)17/h4-7,16-18H,1-3H3.
What are the key properties of 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol?
4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol has a molecular weight of 260.29 g/mol, XLogP of 3.10, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-hydroxy-3-methoxy-2,4-dimethylphenyl)benzene-1,3-diol is sourced from PubChem (CID 146162008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).