C18H14N2O8 — CID 146163352
7,9-bis(ethoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2-carboxylic acid (PubChem CID 146163352) has the molecular formula C18H14N2O8 and a molecular weight of 386.32 g/mol. Its IUPAC name is 7,9-bis(ethoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2-carboxylic acid.
| Compound Name | 7,9-bis(ethoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 146163352 |
| Molecular Formula | C18H14N2O8 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 7,9-bis(ethoxycarbonyl)-4,5-dioxo-1H-pyrrolo[2,3-f]quinoline-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc(C(=O)OCC)c2c(n1)C(=O)C(=O)c1cc(C(=O)O)[nH]c1-2 |
| InChI | InChI=1S/C18H14N2O8/c1-3-27-17(25)7-5-10(18(26)28-4-2)20-13-11(7)12-8(14(21)15(13)22)6-9(19-12)16(23)24/h5-6,19H,3-4H2,1-2H3,(H,23,24) |
| InChIKey | NLERRPYWVCWHOF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 152.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|